C23H34IN5O4 — CID 111837902
1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide (PubChem CID 111837902) has the molecular formula C23H34IN5O4 and a molecular weight of 571.46 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111837902 |
| Molecular Formula | C23H34IN5O4 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(2-pyridin-3-yloxyethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCOc1cccnc1)NCC(c1ccc(OC)c(OC)c1)N1CCOCC1.I |
| InChI | InChI=1S/C23H33N5O4.HI/c1-24-23(26-9-12-32-19-5-4-8-25-16-19)27-17-20(28-10-13-31-14-11-28)18-6-7-21(29-2)22(15-18)30-3;/h4-8,15-16,20H,9-14,17H2,1-3H3,(H2,24,26,27);1H |
| InChIKey | QUSIXRBWZVJWAN-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|