C10H14O4S — CID 11183823
(2R)-4-(benzenesulfonyl)butane-1,2-diol (PubChem CID 11183823) has the molecular formula C10H14O4S and a molecular weight of 230.29 g/mol. Its IUPAC name is (2R)-4-(benzenesulfonyl)butane-1,2-diol.
| Compound Name | (2R)-4-(benzenesulfonyl)butane-1,2-diol |
|---|---|
| PubChem CID | 11183823 |
| Molecular Formula | C10H14O4S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | (2R)-4-(benzenesulfonyl)butane-1,2-diol |
| SMILES | O=S(=O)(CC[C@@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C10H14O4S/c11-8-9(12)6-7-15(13,14)10-4-2-1-3-5-10/h1-5,9,11-12H,6-8H2/t9-/m1/s1 |
| InChIKey | XFZFWSREITWFDD-SECBINFHSA-N |
| XLogP | 0.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |