C20H30FIN4O — CID 111842767
2-[[N-(2-bicyclo[2.2.1]heptanyl)-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111842767) has the molecular formula C20H30FIN4O and a molecular weight of 488.39 g/mol. Its IUPAC name is 2-[[N-(2-bicyclo[2.2.1]heptanyl)-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-(2-bicyclo[2.2.1]heptanyl)-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111842767 |
| Molecular Formula | C20H30FIN4O |
| Molecular Weight | 488.39 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 2-[[N-(2-bicyclo[2.2.1]heptanyl)-N'-[(3-fluoro-4-methylphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | Cc1ccc(C/N=C(\NCC(=O)N(C)C)NC2CC3CCC2C3)cc1F.I |
| InChI | InChI=1S/C20H29FN4O.HI/c1-13-4-5-15(9-17(13)21)11-22-20(23-12-19(26)25(2)3)24-18-10-14-6-7-16(18)8-14;/h4-5,9,14,16,18H,6-8,10-12H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | UTJVBGCQFDEMBB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.39 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|