C22H35IN4O4 — CID 111842567
2-[[N-(2-bicyclo[2.2.1]heptanyl)-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111842567) has the molecular formula C22H35IN4O4 and a molecular weight of 546.45 g/mol. Its IUPAC name is 2-[[N-(2-bicyclo[2.2.1]heptanyl)-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[N-(2-bicyclo[2.2.1]heptanyl)-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111842567 |
| Molecular Formula | C22H35IN4O4 |
| Molecular Weight | 546.45 g/mol |
| Exact Mass | 546.17 |
| IUPAC Name | 2-[[N-(2-bicyclo[2.2.1]heptanyl)-N'-[(3,4,5-trimethoxyphenyl)methyl]carbamimidoyl]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | COc1cc(C/N=C(\NCC(=O)N(C)C)NC2CC3CCC2C3)cc(OC)c1OC.I |
| InChI | InChI=1S/C22H34N4O4.HI/c1-26(2)20(27)13-24-22(25-17-9-14-6-7-16(17)8-14)23-12-15-10-18(28-3)21(30-5)19(11-15)29-4;/h10-11,14,16-17H,6-9,12-13H2,1-5H3,(H2,23,24,25);1H |
| InChIKey | BIUPJBPWJDVOTR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|