C20H24IN5O2 — CID 111843735
2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111843735) has the molecular formula C20H24IN5O2 and a molecular weight of 493.35 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111843735 |
| Molecular Formula | C20H24IN5O2 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-1-ethyl-3-(2-imidazo[1,2-a]pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc2c(c1)OCO2)NCCc1cn2ccccc2n1.I |
| InChI | InChI=1S/C20H23N5O2.HI/c1-2-21-20(23-12-15-6-7-17-18(11-15)27-14-26-17)22-9-8-16-13-25-10-4-3-5-19(25)24-16;/h3-7,10-11,13H,2,8-9,12,14H2,1H3,(H2,21,22,23);1H |
| InChIKey | BZWMGNUWINAVSG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|