C19H21N3O2 — CID 111844166
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(2-phenylcyclopropyl)guanidine (PubChem CID 111844166) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(2-phenylcyclopropyl)guanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(2-phenylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 111844166 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-(2-phenylcyclopropyl)guanidine |
| SMILES | C/N=C(\NCc1ccc2c(c1)OCO2)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C19H21N3O2/c1-20-19(22-16-10-15(16)14-5-3-2-4-6-14)21-11-13-7-8-17-18(9-13)24-12-23-17/h2-9,15-16H,10-12H2,1H3,(H2,20,21,22) |
| InChIKey | MZBRAWSQIXJODM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|