C21H25N3O2 — CID 111380773
2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-ethyl-3-(2-phenylcyclopropyl)guanidine (PubChem CID 111380773) has the molecular formula C21H25N3O2 and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-ethyl-3-(2-phenylcyclopropyl)guanidine.
| Compound Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-ethyl-3-(2-phenylcyclopropyl)guanidine |
|---|---|
| PubChem CID | 111380773 |
| Molecular Formula | C21H25N3O2 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.19 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-yl)ethyl]-1-ethyl-3-(2-phenylcyclopropyl)guanidine |
| SMILES | CCN/C(=N\CCc1ccc2c(c1)OCO2)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C21H25N3O2/c1-2-22-21(24-18-13-17(18)16-6-4-3-5-7-16)23-11-10-15-8-9-19-20(12-15)26-14-25-19/h3-9,12,17-18H,2,10-11,13-14H2,1H3,(H2,22,23,24) |
| InChIKey | XCVRZSPZJMWDCR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|