About 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine
1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine (PubChem CID 11184894) has the molecular formula C18H15N3
and a molecular weight of 273.34 g/mol. Its IUPAC name is 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine |
| PubChem CID | 11184894 |
| Molecular Formula | C18H15N3 |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine |
| SMILES | c1ccc(C2=NCCn3c2ccc3-c2cccnc2)cc1 |
| InChI | InChI=1S/C18H15N3/c1-2-5-14(6-3-1)18-17-9-8-16(21(17)12-11-20-18)15-7-4-10-19-13-15/h1-10,13H,11-12H2 |
| InChIKey | HKICJPPKZLNUQD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine?
The IUPAC name of 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine (CID 11184894) is 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine.
What is the SMILES notation for 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine?
The canonical SMILES for 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine is c1ccc(C2=NCCn3c2ccc3-c2cccnc2)cc1.
What is the InChIKey of 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine?
The InChIKey is HKICJPPKZLNUQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15N3/c1-2-5-14(6-3-1)18-17-9-8-16(21(17)12-11-20-18)15-7-4-10-19-13-15/h1-10,13H,11-12H2.
What are the key properties of 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine?
1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine has a molecular weight of 273.34 g/mol, XLogP of 3.40, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenyl-6-pyridin-3-yl-3,4-dihydropyrrolo[1,2-a]pyrazine is sourced from PubChem (CID 11184894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).