About N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine
N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine (PubChem CID 140905429) has the molecular formula C17H15N5
and a molecular weight of 289.34 g/mol. Its IUPAC name is N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine.
Molecular Properties
| Compound Name | N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine |
| PubChem CID | 140905429 |
| Molecular Formula | C17H15N5 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine |
| SMILES | c1ccc(C/N=C2\Cc3ncc(-c4cccnc4)n3N2)cc1 |
| InChI | InChI=1S/C17H15N5/c1-2-5-13(6-3-1)10-19-16-9-17-20-12-15(22(17)21-16)14-7-4-8-18-11-14/h1-8,11-12H,9-10H2,(H,19,21) |
| InChIKey | AABPOUPASPLTNT-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine?
The IUPAC name of N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine (CID 140905429) is N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine.
What is the SMILES notation for N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine?
The canonical SMILES for N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine is c1ccc(C/N=C2\Cc3ncc(-c4cccnc4)n3N2)cc1.
What is the InChIKey of N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine?
The InChIKey is AABPOUPASPLTNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15N5/c1-2-5-13(6-3-1)10-19-16-9-17-20-12-15(22(17)21-16)14-7-4-8-18-11-14/h1-8,11-12H,9-10H2,(H,19,21).
What are the key properties of N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine?
N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine has a molecular weight of 289.34 g/mol, XLogP of 2.64, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-3-pyridin-3-yl-5,7-dihydroimidazo[1,2-b]pyrazol-6-imine is sourced from PubChem (CID 140905429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).