C18H16BN5 — CID 136617320
CID 136617320 (PubChem CID 136617320) has the molecular formula C18H16BN5 and a molecular weight of 313.17 g/mol.
| Compound Name | CID 136617320 |
|---|---|
| PubChem CID | 136617320 |
| Molecular Formula | C18H16BN5 |
| Molecular Weight | 313.17 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | — |
| SMILES | [B]C1=C(c2ccccc2)N/C(=N/Cc2cccnc2)C2=NCCN21 |
| InChI | InChI=1S/C18H16BN5/c19-16-15(14-6-2-1-3-7-14)23-17(18-21-9-10-24(16)18)22-12-13-5-4-8-20-11-13/h1-8,11H,9-10,12H2,(H,22,23) |
| InChIKey | BGDMFEOBSSCSIU-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.17 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|