C14H13N3 — CID 71659870
3-(2-phenyl-4,5-dihydroimidazol-1-yl)pyridine (PubChem CID 71659870) has the molecular formula C14H13N3 and a molecular weight of 223.28 g/mol. Its IUPAC name is 3-(2-phenyl-4,5-dihydroimidazol-1-yl)pyridine.
| Compound Name | 3-(2-phenyl-4,5-dihydroimidazol-1-yl)pyridine |
|---|---|
| PubChem CID | 71659870 |
| Molecular Formula | C14H13N3 |
| Molecular Weight | 223.28 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 3-(2-phenyl-4,5-dihydroimidazol-1-yl)pyridine |
| SMILES | c1ccc(C2=NCCN2c2cccnc2)cc1 |
| InChI | InChI=1S/C14H13N3/c1-2-5-12(6-3-1)14-16-9-10-17(14)13-7-4-8-15-11-13/h1-8,11H,9-10H2 |
| InChIKey | CDCRGXOHUAXANH-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |