C16H22O4 — CID 11185028
(4aR,5S,8R,9aR)-8-hydroxy-9a-methoxy-3,4a,5-trimethyl-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one (PubChem CID 11185028) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (4aR,5S,8R,9aR)-8-hydroxy-9a-methoxy-3,4a,5-trimethyl-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one.
| Compound Name | (4aR,5S,8R,9aR)-8-hydroxy-9a-methoxy-3,4a,5-trimethyl-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
|---|---|
| PubChem CID | 11185028 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (4aR,5S,8R,9aR)-8-hydroxy-9a-methoxy-3,4a,5-trimethyl-5,6,7,8-tetrahydro-4H-benzo[f][1]benzofuran-2-one |
| SMILES | CO[C@@]12C=C3[C@H](O)CC[C@H](C)[C@@]3(C)CC1=C(C)C(=O)O2 |
| InChI | InChI=1S/C16H22O4/c1-9-5-6-13(17)12-8-16(19-4)11(7-15(9,12)3)10(2)14(18)20-16/h8-9,13,17H,5-7H2,1-4H3/t9-,13+,15+,16+/m0/s1 |
| InChIKey | KOPBXBMGJCLPOI-CZLJMHDISA-N |
| XLogP | 2.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|