C13H20FN3 — CID 111854366
3-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-1,1-dimethylguanidine (PubChem CID 111854366) has the molecular formula C13H20FN3 and a molecular weight of 237.32 g/mol. Its IUPAC name is 3-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-1,1-dimethylguanidine.
| Compound Name | 3-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-1,1-dimethylguanidine |
|---|---|
| PubChem CID | 111854366 |
| Molecular Formula | C13H20FN3 |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 3-ethyl-2-[(4-fluoro-3-methylphenyl)methyl]-1,1-dimethylguanidine |
| SMILES | CCN/C(=N/Cc1ccc(F)c(C)c1)N(C)C |
| InChI | InChI=1S/C13H20FN3/c1-5-15-13(17(3)4)16-9-11-6-7-12(14)10(2)8-11/h6-8H,5,9H2,1-4H3,(H,15,16) |
| InChIKey | RRVVWIZMOLKFBY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|