C23H26F3IN4O2 — CID 111856887
1-ethyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111856887) has the molecular formula C23H26F3IN4O2 and a molecular weight of 574.39 g/mol. Its IUPAC name is 1-ethyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111856887 |
| Molecular Formula | C23H26F3IN4O2 |
| Molecular Weight | 574.39 g/mol |
| Exact Mass | 574.11 |
| IUPAC Name | 1-ethyl-3-[(5-phenyl-1,2-oxazol-3-yl)methyl]-2-[[4-(2,2,2-trifluoroethoxymethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(COCC(F)(F)F)cc1)NCc1cc(-c2ccccc2)on1.I |
| InChI | InChI=1S/C23H25F3N4O2.HI/c1-2-27-22(29-14-20-12-21(32-30-20)19-6-4-3-5-7-19)28-13-17-8-10-18(11-9-17)15-31-16-23(24,25)26;/h3-12H,2,13-16H2,1H3,(H2,27,28,29);1H |
| InChIKey | CXMQSOFKNZMYEC-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 71.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.39 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|