About ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate
ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate (PubChem CID 11186512) has the molecular formula C17H16FN3O3
and a molecular weight of 329.33 g/mol. Its IUPAC name is ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate |
| PubChem CID | 11186512 |
| Molecular Formula | C17H16FN3O3 |
| Molecular Weight | 329.33 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate |
| SMILES | CCOC(=O)C1=CN(C(=O)c2ccc(F)cc2)CCc2[nH]cnc21 |
| InChI | InChI=1S/C17H16FN3O3/c1-2-24-17(23)13-9-21(8-7-14-15(13)20-10-19-14)16(22)11-3-5-12(18)6-4-11/h3-6,9-10H,2,7-8H2,1H3,(H,19,20) |
| InChIKey | XGRGDOIDUKQZFU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate?
The IUPAC name of ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate (CID 11186512) is ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate.
What is the SMILES notation for ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate?
The canonical SMILES for ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate is CCOC(=O)C1=CN(C(=O)c2ccc(F)cc2)CCc2[nH]cnc21.
What is the InChIKey of ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate?
The InChIKey is XGRGDOIDUKQZFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16FN3O3/c1-2-24-17(23)13-9-21(8-7-14-15(13)20-10-19-14)16(22)11-3-5-12(18)6-4-11/h3-6,9-10H,2,7-8H2,1H3,(H,19,20).
What are the key properties of ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate?
ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate has a molecular weight of 329.33 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-(4-fluorobenzoyl)-7,8-dihydro-1H-imidazo[4,5-d]azepine-4-carboxylate is sourced from PubChem (CID 11186512), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).