C20H18F3N3O2 — CID 111866746
1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine (PubChem CID 111866746) has the molecular formula C20H18F3N3O2 and a molecular weight of 389.38 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
|---|---|
| PubChem CID | 111866746 |
| Molecular Formula | C20H18F3N3O2 |
| Molecular Weight | 389.38 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-2-methyl-3-[3-[3-(trifluoromethyl)phenyl]prop-2-ynyl]guanidine |
| SMILES | C/N=C(\NCC#Cc1cccc(C(F)(F)F)c1)NCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H18F3N3O2/c1-24-19(26-12-15-7-8-17-18(11-15)28-13-27-17)25-9-3-5-14-4-2-6-16(10-14)20(21,22)23/h2,4,6-8,10-11H,9,12-13H2,1H3,(H2,24,25,26) |
| InChIKey | VXBNASBKWQPSJX-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|