C22H28N2O — CID 11186742
1-[(3aS,8bS)-4,8b-bis(3-methylbut-2-enyl)-3aH-pyrrolo[2,3-b]indol-3-yl]ethanone (PubChem CID 11186742) has the molecular formula C22H28N2O and a molecular weight of 336.48 g/mol. Its IUPAC name is 1-[(3aS,8bS)-4,8b-bis(3-methylbut-2-enyl)-3aH-pyrrolo[2,3-b]indol-3-yl]ethanone.
| Compound Name | 1-[(3aS,8bS)-4,8b-bis(3-methylbut-2-enyl)-3aH-pyrrolo[2,3-b]indol-3-yl]ethanone |
|---|---|
| PubChem CID | 11186742 |
| Molecular Formula | C22H28N2O |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.22 |
| IUPAC Name | 1-[(3aS,8bS)-4,8b-bis(3-methylbut-2-enyl)-3aH-pyrrolo[2,3-b]indol-3-yl]ethanone |
| SMILES | CC(=O)N1C=C[C@@]2(CC=C(C)C)c3ccccc3N(CC=C(C)C)[C@@H]12 |
| InChI | InChI=1S/C22H28N2O/c1-16(2)10-12-22-13-15-23(18(5)25)21(22)24(14-11-17(3)4)20-9-7-6-8-19(20)22/h6-11,13,15,21H,12,14H2,1-5H3/t21-,22+/m1/s1 |
| InChIKey | DBXLTJSVPOCBQR-YADHBBJMSA-N |
| XLogP | 4.77 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|