C19H18O6 — CID 11186922
(2-methoxyphenyl) (4R,5S)-2-oxo-5-(2-phenylethyl)-1,3-dioxolane-4-carboxylate (PubChem CID 11186922) has the molecular formula C19H18O6 and a molecular weight of 342.35 g/mol. Its IUPAC name is (2-methoxyphenyl) (4R,5S)-2-oxo-5-(2-phenylethyl)-1,3-dioxolane-4-carboxylate.
| Compound Name | (2-methoxyphenyl) (4R,5S)-2-oxo-5-(2-phenylethyl)-1,3-dioxolane-4-carboxylate |
|---|---|
| PubChem CID | 11186922 |
| Molecular Formula | C19H18O6 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | (2-methoxyphenyl) (4R,5S)-2-oxo-5-(2-phenylethyl)-1,3-dioxolane-4-carboxylate |
| SMILES | COc1ccccc1OC(=O)[C@@H]1OC(=O)O[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C19H18O6/c1-22-14-9-5-6-10-15(14)23-18(20)17-16(24-19(21)25-17)12-11-13-7-3-2-4-8-13/h2-10,16-17H,11-12H2,1H3/t16-,17+/m0/s1 |
| InChIKey | IOVZYPORRPFSEY-DLBZAZTESA-N |
| XLogP | 3.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|