C23H38O4Si — CID 140807471
methyl (2S,3S,4R,5R,6S)-3,5-dimethyl-6-(2-phenylethyl)-4-triethylsilyloxyoxane-2-carboxylate (PubChem CID 140807471) has the molecular formula C23H38O4Si and a molecular weight of 406.64 g/mol. Its IUPAC name is methyl (2S,3S,4R,5R,6S)-3,5-dimethyl-6-(2-phenylethyl)-4-triethylsilyloxyoxane-2-carboxylate.
| Compound Name | methyl (2S,3S,4R,5R,6S)-3,5-dimethyl-6-(2-phenylethyl)-4-triethylsilyloxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 140807471 |
| Molecular Formula | C23H38O4Si |
| Molecular Weight | 406.64 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | methyl (2S,3S,4R,5R,6S)-3,5-dimethyl-6-(2-phenylethyl)-4-triethylsilyloxyoxane-2-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H]1[C@@H](C)[C@@H](C(=O)OC)O[C@@H](CCc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C23H38O4Si/c1-7-28(8-2,9-3)27-21-17(4)20(16-15-19-13-11-10-12-14-19)26-22(18(21)5)23(24)25-6/h10-14,17-18,20-22H,7-9,15-16H2,1-6H3/t17-,18-,20+,21-,22+/m1/s1 |
| InChIKey | MUNOFVUHOIDXST-MPAQAYSTSA-N |
| XLogP | 5.22 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.64 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|