C21H27N5 — CID 11187185
N'-[(3-methyl-2-pyridinyl)methyl]-N'-[(2-phenyl-1H-imidazol-5-yl)methyl]butane-1,4-diamine (PubChem CID 11187185) has the molecular formula C21H27N5 and a molecular weight of 349.48 g/mol. Its IUPAC name is N'-[(3-methyl-2-pyridinyl)methyl]-N'-[(2-phenyl-1H-imidazol-5-yl)methyl]butane-1,4-diamine.
| Compound Name | N'-[(3-methyl-2-pyridinyl)methyl]-N'-[(2-phenyl-1H-imidazol-5-yl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 11187185 |
| Molecular Formula | C21H27N5 |
| Molecular Weight | 349.48 g/mol |
| Exact Mass | 349.23 |
| IUPAC Name | N'-[(3-methyl-2-pyridinyl)methyl]-N'-[(2-phenyl-1H-imidazol-5-yl)methyl]butane-1,4-diamine |
| SMILES | Cc1cccnc1CN(CCCCN)Cc1cnc(-c2ccccc2)[nH]1 |
| InChI | InChI=1S/C21H27N5/c1-17-8-7-12-23-20(17)16-26(13-6-5-11-22)15-19-14-24-21(25-19)18-9-3-2-4-10-18/h2-4,7-10,12,14H,5-6,11,13,15-16,22H2,1H3,(H,24,25) |
| InChIKey | OFLKDPWMAVLQCQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|