C22H33N5O — CID 25177707
N'-[(3,5-dimethyl-2-pyridinyl)methyl]-N'-[(3-morpholin-4-yl-2-pyridinyl)methyl]butane-1,4-diamine (PubChem CID 25177707) has the molecular formula C22H33N5O and a molecular weight of 383.54 g/mol. Its IUPAC name is N'-[(3,5-dimethyl-2-pyridinyl)methyl]-N'-[(3-morpholin-4-yl-2-pyridinyl)methyl]butane-1,4-diamine.
| Compound Name | N'-[(3,5-dimethyl-2-pyridinyl)methyl]-N'-[(3-morpholin-4-yl-2-pyridinyl)methyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 25177707 |
| Molecular Formula | C22H33N5O |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.27 |
| IUPAC Name | N'-[(3,5-dimethyl-2-pyridinyl)methyl]-N'-[(3-morpholin-4-yl-2-pyridinyl)methyl]butane-1,4-diamine |
| SMILES | Cc1cnc(CN(CCCCN)Cc2ncccc2N2CCOCC2)c(C)c1 |
| InChI | InChI=1S/C22H33N5O/c1-18-14-19(2)20(25-15-18)16-26(9-4-3-7-23)17-21-22(6-5-8-24-21)27-10-12-28-13-11-27/h5-6,8,14-15H,3-4,7,9-13,16-17,23H2,1-2H3 |
| InChIKey | HEIVDFNROAQHEQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|