C24H41IN4O4 — CID 111872476
3-[[N'-[3-(oxolan-2-ylmethoxy)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide (PubChem CID 111872476) has the molecular formula C24H41IN4O4 and a molecular weight of 576.52 g/mol. Its IUPAC name is 3-[[N'-[3-(oxolan-2-ylmethoxy)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide.
| Compound Name | 3-[[N'-[3-(oxolan-2-ylmethoxy)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111872476 |
| Molecular Formula | C24H41IN4O4 |
| Molecular Weight | 576.52 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 3-[[N'-[3-(oxolan-2-ylmethoxy)propyl]-N-(4-propan-2-yloxyphenyl)carbamimidoyl]amino]-N-propan-2-ylpropanamide;hydroiodide |
| SMILES | CC(C)NC(=O)CCN/C(=N\CCCOCC1CCCO1)Nc1ccc(OC(C)C)cc1.I |
| InChI | InChI=1S/C24H40N4O4.HI/c1-18(2)27-23(29)12-14-26-24(25-13-6-15-30-17-22-7-5-16-31-22)28-20-8-10-21(11-9-20)32-19(3)4;/h8-11,18-19,22H,5-7,12-17H2,1-4H3,(H,27,29)(H2,25,26,28);1H |
| InChIKey | RVXBQRQEKHCHIS-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.52 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|