C21H35N3O5S — CID 111872501
1-(2-methylsulfonylethyl)-2-[3-(oxolan-2-ylmethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine (PubChem CID 111872501) has the molecular formula C21H35N3O5S and a molecular weight of 441.59 g/mol. Its IUPAC name is 1-(2-methylsulfonylethyl)-2-[3-(oxolan-2-ylmethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine.
| Compound Name | 1-(2-methylsulfonylethyl)-2-[3-(oxolan-2-ylmethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine |
|---|---|
| PubChem CID | 111872501 |
| Molecular Formula | C21H35N3O5S |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | 1-(2-methylsulfonylethyl)-2-[3-(oxolan-2-ylmethoxy)propyl]-3-(4-propan-2-yloxyphenyl)guanidine |
| SMILES | CC(C)Oc1ccc(N/C(=N/CCCOCC2CCCO2)NCCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C21H35N3O5S/c1-17(2)29-19-9-7-18(8-10-19)24-21(23-12-15-30(3,25)26)22-11-5-13-27-16-20-6-4-14-28-20/h7-10,17,20H,4-6,11-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | DRIVUQNJBMGHRR-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 98.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|