C19H34O4Si — CID 11187370
methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3S,5R)-3-hydroxy-2-methylidene-5-prop-1-en-2-ylcyclohexyl]acetate (PubChem CID 11187370) has the molecular formula C19H34O4Si and a molecular weight of 354.56 g/mol. Its IUPAC name is methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3S,5R)-3-hydroxy-2-methylidene-5-prop-1-en-2-ylcyclohexyl]acetate.
| Compound Name | methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3S,5R)-3-hydroxy-2-methylidene-5-prop-1-en-2-ylcyclohexyl]acetate |
|---|---|
| PubChem CID | 11187370 |
| Molecular Formula | C19H34O4Si |
| Molecular Weight | 354.56 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | methyl (2R)-2-[tert-butyl(dimethyl)silyl]oxy-2-[(1R,3S,5R)-3-hydroxy-2-methylidene-5-prop-1-en-2-ylcyclohexyl]acetate |
| SMILES | C=C(C)[C@@H]1C[C@@H]([C@@H](O[Si](C)(C)C(C)(C)C)C(=O)OC)C(=C)[C@@H](O)C1 |
| InChI | InChI=1S/C19H34O4Si/c1-12(2)14-10-15(13(3)16(20)11-14)17(18(21)22-7)23-24(8,9)19(4,5)6/h14-17,20H,1,3,10-11H2,2,4-9H3/t14-,15-,16+,17-/m1/s1 |
| InChIKey | AJIMIBKUZMDHHD-WCXIOVBPSA-N |
| XLogP | 4.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|