C20H33N3O4 — CID 11188151
tert-butyl N-[1-[(1S,3S,5S)-3-carbamoyl-2-azabicyclo[3.1.0]hexan-2-yl]-3,3-diethyl-1-oxopent-4-en-2-yl]carbamate (PubChem CID 11188151) has the molecular formula C20H33N3O4 and a molecular weight of 379.50 g/mol. Its IUPAC name is tert-butyl N-[1-[(1S,3S,5S)-3-carbamoyl-2-azabicyclo[3.1.0]hexan-2-yl]-3,3-diethyl-1-oxopent-4-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(1S,3S,5S)-3-carbamoyl-2-azabicyclo[3.1.0]hexan-2-yl]-3,3-diethyl-1-oxopent-4-en-2-yl]carbamate |
|---|---|
| PubChem CID | 11188151 |
| Molecular Formula | C20H33N3O4 |
| Molecular Weight | 379.50 g/mol |
| Exact Mass | 379.25 |
| IUPAC Name | tert-butyl N-[1-[(1S,3S,5S)-3-carbamoyl-2-azabicyclo[3.1.0]hexan-2-yl]-3,3-diethyl-1-oxopent-4-en-2-yl]carbamate |
| SMILES | C=CC(CC)(CC)C(NC(=O)OC(C)(C)C)C(=O)N1[C@H](C(N)=O)C[C@@H]2C[C@@H]21 |
| InChI | InChI=1S/C20H33N3O4/c1-7-20(8-2,9-3)15(22-18(26)27-19(4,5)6)17(25)23-13-10-12(13)11-14(23)16(21)24/h7,12-15H,1,8-11H2,2-6H3,(H2,21,24)(H,22,26)/t12-,13-,14-,15?/m0/s1 |
| InChIKey | FDZBUSGLCVOXNZ-LOKSQKBWSA-N |
| XLogP | 2.35 |
| TPSA | 101.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.50 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|