C21H38IN5O2 — CID 111884780
tert-butyl N-[2-[[N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide (PubChem CID 111884780) has the molecular formula C21H38IN5O2 and a molecular weight of 519.47 g/mol. Its IUPAC name is tert-butyl N-[2-[[N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide.
| Compound Name | tert-butyl N-[2-[[N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
|---|---|
| PubChem CID | 111884780 |
| Molecular Formula | C21H38IN5O2 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | tert-butyl N-[2-[[N'-methyl-N-[[2-[[methyl(propan-2-yl)amino]methyl]phenyl]methyl]carbamimidoyl]amino]ethyl]carbamate;hydroiodide |
| SMILES | C/N=C(\NCCNC(=O)OC(C)(C)C)NCc1ccccc1CN(C)C(C)C.I |
| InChI | InChI=1S/C21H37N5O2.HI/c1-16(2)26(7)15-18-11-9-8-10-17(18)14-25-19(22-6)23-12-13-24-20(27)28-21(3,4)5;/h8-11,16H,12-15H2,1-7H3,(H,24,27)(H2,22,23,25);1H |
| InChIKey | YUHCXSCWVPTLLQ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|