C21H32N6O2 — CID 111886899
tert-butyl N-[3-[[N-ethyl-N'-[(5-phenyl-1H-imidazol-2-yl)methyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111886899) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[(5-phenyl-1H-imidazol-2-yl)methyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[(5-phenyl-1H-imidazol-2-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886899 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[(5-phenyl-1H-imidazol-2-yl)methyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\Cc1ncc(-c2ccccc2)[nH]1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H32N6O2/c1-5-22-19(23-12-9-13-24-20(28)29-21(2,3)4)26-15-18-25-14-17(27-18)16-10-7-6-8-11-16/h6-8,10-11,14H,5,9,12-13,15H2,1-4H3,(H,24,28)(H,25,27)(H2,22,23,26) |
| InChIKey | DTBIZVVQPYACHB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|