C19H22F3N3O4 — CID 11189136
[(2S)-4-amino-1-(3-naphthalen-1-ylpropylamino)-1,4-dioxobutan-2-yl]azanium;2,2,2-trifluoroacetate (PubChem CID 11189136) has the molecular formula C19H22F3N3O4 and a molecular weight of 413.40 g/mol. Its IUPAC name is [(2S)-4-amino-1-(3-naphthalen-1-ylpropylamino)-1,4-dioxobutan-2-yl]azanium;2,2,2-trifluoroacetate.
| Compound Name | [(2S)-4-amino-1-(3-naphthalen-1-ylpropylamino)-1,4-dioxobutan-2-yl]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11189136 |
| Molecular Formula | C19H22F3N3O4 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [(2S)-4-amino-1-(3-naphthalen-1-ylpropylamino)-1,4-dioxobutan-2-yl]azanium;2,2,2-trifluoroacetate |
| SMILES | NC(=O)C[C@H]([NH3+])C(=O)NCCCc1cccc2ccccc12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C17H21N3O2.C2HF3O2/c18-15(11-16(19)21)17(22)20-10-4-8-13-7-3-6-12-5-1-2-9-14(12)13;3-2(4,5)1(6)7/h1-3,5-7,9,15H,4,8,10-11,18H2,(H2,19,21)(H,20,22);(H,6,7)/t15-;/m0./s1 |
| InChIKey | JVQJOQBQFNMFTR-RSAXXLAASA-N |
| XLogP | -0.33 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|