C17H20F3IN4OS — CID 111898652
2-[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide (PubChem CID 111898652) has the molecular formula C17H20F3IN4OS and a molecular weight of 512.34 g/mol. Its IUPAC name is 2-[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111898652 |
| Molecular Formula | C17H20F3IN4OS |
| Molecular Weight | 512.34 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 2-[[ethylamino-[(5-methylthiophen-2-yl)methylamino]methylidene]amino]-N-(2,3,4-trifluorophenyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)c(F)c1F)NCc1ccc(C)s1.I |
| InChI | InChI=1S/C17H19F3N4OS.HI/c1-3-21-17(22-8-11-5-4-10(2)26-11)23-9-14(25)24-13-7-6-12(18)15(19)16(13)20;/h4-7H,3,8-9H2,1-2H3,(H,24,25)(H2,21,22,23);1H |
| InChIKey | ZFIAWPWZFDFNIE-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|