C16H24F2IN3O — CID 111901640
2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[2-(oxolan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111901640) has the molecular formula C16H24F2IN3O and a molecular weight of 439.29 g/mol. Its IUPAC name is 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[2-(oxolan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[2-(oxolan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111901640 |
| Molecular Formula | C16H24F2IN3O |
| Molecular Weight | 439.29 g/mol |
| Exact Mass | 439.09 |
| IUPAC Name | 2-[(2,5-difluorophenyl)methyl]-1-ethyl-3-[2-(oxolan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(F)ccc1F)NCCC1CCCO1.I |
| InChI | InChI=1S/C16H23F2N3O.HI/c1-2-19-16(20-8-7-14-4-3-9-22-14)21-11-12-10-13(17)5-6-15(12)18;/h5-6,10,14H,2-4,7-9,11H2,1H3,(H2,19,20,21);1H |
| InChIKey | UAQIMGXUFARMRZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.29 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|