C20H26F2N4O2S — CID 111901875
1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine (PubChem CID 111901875) has the molecular formula C20H26F2N4O2S and a molecular weight of 424.52 g/mol. Its IUPAC name is 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine.
| Compound Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine |
|---|---|
| PubChem CID | 111901875 |
| Molecular Formula | C20H26F2N4O2S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 1-[(2,5-difluorophenyl)methyl]-2-methyl-3-[[4-(propan-2-ylsulfamoylmethyl)phenyl]methyl]guanidine |
| SMILES | C/N=C(\NCc1ccc(CS(=O)(=O)NC(C)C)cc1)NCc1cc(F)ccc1F |
| InChI | InChI=1S/C20H26F2N4O2S/c1-14(2)26-29(27,28)13-16-6-4-15(5-7-16)11-24-20(23-3)25-12-17-10-18(21)8-9-19(17)22/h4-10,14,26H,11-13H2,1-3H3,(H2,23,24,25) |
| InChIKey | XDVACRGAZNDNBZ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|