C17H23FN6O — CID 111904435
2-[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide (PubChem CID 111904435) has the molecular formula C17H23FN6O and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 111904435 |
| Molecular Formula | C17H23FN6O |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 2-[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]-N-(4-fluorophenyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)Nc1ccc(F)cc1)NCCCn1cccn1 |
| InChI | InChI=1S/C17H23FN6O/c1-2-19-17(20-9-3-11-24-12-4-10-22-24)21-13-16(25)23-15-7-5-14(18)6-8-15/h4-8,10,12H,2-3,9,11,13H2,1H3,(H,23,25)(H2,19,20,21) |
| InChIKey | PJFJRPAXIVSDQZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|