C20H30N6O — CID 111904893
N-benzyl-N-ethyl-2-[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]acetamide (PubChem CID 111904893) has the molecular formula C20H30N6O and a molecular weight of 370.50 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]acetamide.
| Compound Name | N-benzyl-N-ethyl-2-[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111904893 |
| Molecular Formula | C20H30N6O |
| Molecular Weight | 370.50 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | N-benzyl-N-ethyl-2-[[ethylamino-(3-pyrazol-1-ylpropylamino)methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)N(CC)Cc1ccccc1)NCCCn1cccn1 |
| InChI | InChI=1S/C20H30N6O/c1-3-21-20(22-12-8-14-26-15-9-13-24-26)23-16-19(27)25(4-2)17-18-10-6-5-7-11-18/h5-7,9-11,13,15H,3-4,8,12,14,16-17H2,1-2H3,(H2,21,22,23) |
| InChIKey | BLYAAPWZWMMXHD-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 74.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|