C22H29N5O2 — CID 111907417
2-[[[2-(furan-2-yl)ethylamino]-[2-(2-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111907417) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-[[[2-(furan-2-yl)ethylamino]-[2-(2-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[[2-(furan-2-yl)ethylamino]-[2-(2-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111907417 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | 2-[[[2-(furan-2-yl)ethylamino]-[2-(2-methyl-1H-indol-3-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | Cc1[nH]c2ccccc2c1CCN/C(=N/CC(=O)N(C)C)NCCc1ccco1 |
| InChI | InChI=1S/C22H29N5O2/c1-16-18(19-8-4-5-9-20(19)26-16)11-13-24-22(25-15-21(28)27(2)3)23-12-10-17-7-6-14-29-17/h4-9,14,26H,10-13,15H2,1-3H3,(H2,23,24,25) |
| InChIKey | BWZWTVKFRUIXGN-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|