C24H25N3O2 — CID 86882986
1-benzyl-1-(furan-2-ylmethyl)-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea (PubChem CID 86882986) has the molecular formula C24H25N3O2 and a molecular weight of 387.48 g/mol. Its IUPAC name is 1-benzyl-1-(furan-2-ylmethyl)-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea.
| Compound Name | 1-benzyl-1-(furan-2-ylmethyl)-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea |
|---|---|
| PubChem CID | 86882986 |
| Molecular Formula | C24H25N3O2 |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 1-benzyl-1-(furan-2-ylmethyl)-3-[2-(2-methyl-1H-indol-3-yl)ethyl]urea |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)N(Cc1ccccc1)Cc1ccco1 |
| InChI | InChI=1S/C24H25N3O2/c1-18-21(22-11-5-6-12-23(22)26-18)13-14-25-24(28)27(17-20-10-7-15-29-20)16-19-8-3-2-4-9-19/h2-12,15,26H,13-14,16-17H2,1H3,(H,25,28) |
| InChIKey | LHLQWARANVCBIK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|