C22H25N5 — CID 111909667
1-(isoquinolin-1-ylmethyl)-2-methyl-3-(1-phenylpyrrolidin-3-yl)guanidine (PubChem CID 111909667) has the molecular formula C22H25N5 and a molecular weight of 359.48 g/mol. Its IUPAC name is 1-(isoquinolin-1-ylmethyl)-2-methyl-3-(1-phenylpyrrolidin-3-yl)guanidine.
| Compound Name | 1-(isoquinolin-1-ylmethyl)-2-methyl-3-(1-phenylpyrrolidin-3-yl)guanidine |
|---|---|
| PubChem CID | 111909667 |
| Molecular Formula | C22H25N5 |
| Molecular Weight | 359.48 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 1-(isoquinolin-1-ylmethyl)-2-methyl-3-(1-phenylpyrrolidin-3-yl)guanidine |
| SMILES | C/N=C(\NCc1nccc2ccccc12)NC1CCN(c2ccccc2)C1 |
| InChI | InChI=1S/C22H25N5/c1-23-22(25-15-21-20-10-6-5-7-17(20)11-13-24-21)26-18-12-14-27(16-18)19-8-3-2-4-9-19/h2-11,13,18H,12,14-16H2,1H3,(H2,23,25,26) |
| InChIKey | SVTLDZTVMQJQJG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.48 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|