C16H25IN4 — CID 111910586
2-methyl-1-(2-methylcyclopropyl)-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide (PubChem CID 111910586) has the molecular formula C16H25IN4 and a molecular weight of 400.31 g/mol. Its IUPAC name is 2-methyl-1-(2-methylcyclopropyl)-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-(2-methylcyclopropyl)-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111910586 |
| Molecular Formula | C16H25IN4 |
| Molecular Weight | 400.31 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | 2-methyl-1-(2-methylcyclopropyl)-3-(1-phenylpyrrolidin-3-yl)guanidine;hydroiodide |
| SMILES | C/N=C(/NC1CCN(c2ccccc2)C1)NC1CC1C.I |
| InChI | InChI=1S/C16H24N4.HI/c1-12-10-15(12)19-16(17-2)18-13-8-9-20(11-13)14-6-4-3-5-7-14;/h3-7,12-13,15H,8-11H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | HSAGQLZUEAVMFJ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|