C13H22N4 — CID 111911260
1,2-dimethyl-3-(3-methyl-2-pyridin-3-ylbutyl)guanidine (PubChem CID 111911260) has the molecular formula C13H22N4 and a molecular weight of 234.35 g/mol. Its IUPAC name is 1,2-dimethyl-3-(3-methyl-2-pyridin-3-ylbutyl)guanidine.
| Compound Name | 1,2-dimethyl-3-(3-methyl-2-pyridin-3-ylbutyl)guanidine |
|---|---|
| PubChem CID | 111911260 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 1,2-dimethyl-3-(3-methyl-2-pyridin-3-ylbutyl)guanidine |
| SMILES | C/N=C(\NC)NCC(c1cccnc1)C(C)C |
| InChI | InChI=1S/C13H22N4/c1-10(2)12(9-17-13(14-3)15-4)11-6-5-7-16-8-11/h5-8,10,12H,9H2,1-4H3,(H2,14,15,17) |
| InChIKey | YSNLEAPESLOXKN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 49.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|