C22H33F3N4O2 — CID 111915415
2-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine (PubChem CID 111915415) has the molecular formula C22H33F3N4O2 and a molecular weight of 442.53 g/mol. Its IUPAC name is 2-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine.
| Compound Name | 2-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
|---|---|
| PubChem CID | 111915415 |
| Molecular Formula | C22H33F3N4O2 |
| Molecular Weight | 442.53 g/mol |
| Exact Mass | 442.26 |
| IUPAC Name | 2-[(3-cyclopentyloxy-4-methoxyphenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OC)c(OC2CCCC2)c1)NC1CCN(CC(F)(F)F)C1 |
| InChI | InChI=1S/C22H33F3N4O2/c1-3-26-21(28-17-10-11-29(14-17)15-22(23,24)25)27-13-16-8-9-19(30-2)20(12-16)31-18-6-4-5-7-18/h8-9,12,17-18H,3-7,10-11,13-15H2,1-2H3,(H2,26,27,28) |
| InChIKey | AFIVOUJLMXZSGF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|