C22H34F3IN4O2 — CID 111564107
2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide (PubChem CID 111564107) has the molecular formula C22H34F3IN4O2 and a molecular weight of 570.44 g/mol. Its IUPAC name is 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide.
| Compound Name | 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111564107 |
| Molecular Formula | C22H34F3IN4O2 |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 570.17 |
| IUPAC Name | 2-[(2-cyclopentyloxy-3-methoxyphenyl)methyl]-1-ethyl-3-[1-(2,2,2-trifluoroethyl)pyrrolidin-3-yl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccc(OC)c1OC1CCCC1)NC1CCN(CC(F)(F)F)C1.I |
| InChI | InChI=1S/C22H33F3N4O2.HI/c1-3-26-21(28-17-11-12-29(14-17)15-22(23,24)25)27-13-16-7-6-10-19(30-2)20(16)31-18-8-4-5-9-18;/h6-7,10,17-18H,3-5,8-9,11-15H2,1-2H3,(H2,26,27,28);1H |
| InChIKey | CHRYVTYQQRTMJN-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|