C13H18N2OS2 — CID 111916731
3-[(2-thiophen-2-yl-1,3-thiazol-5-yl)methylamino]pentan-1-ol (PubChem CID 111916731) has the molecular formula C13H18N2OS2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-[(2-thiophen-2-yl-1,3-thiazol-5-yl)methylamino]pentan-1-ol.
| Compound Name | 3-[(2-thiophen-2-yl-1,3-thiazol-5-yl)methylamino]pentan-1-ol |
|---|---|
| PubChem CID | 111916731 |
| Molecular Formula | C13H18N2OS2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 3-[(2-thiophen-2-yl-1,3-thiazol-5-yl)methylamino]pentan-1-ol |
| SMILES | CCC(CCO)NCc1cnc(-c2cccs2)s1 |
| InChI | InChI=1S/C13H18N2OS2/c1-2-10(5-6-16)14-8-11-9-15-13(18-11)12-4-3-7-17-12/h3-4,7,9-10,14,16H,2,5-6,8H2,1H3 |
| InChIKey | URVRPHMXOHHPQH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |