C23H30O14 — CID 11191791
(1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-3-[3-methoxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxycyclohexane-1-carboxylic acid (PubChem CID 11191791) has the molecular formula C23H30O14 and a molecular weight of 530.48 g/mol. Its IUPAC name is (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-3-[3-methoxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxycyclohexane-1-carboxylic acid.
| Compound Name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-3-[3-methoxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 11191791 |
| Molecular Formula | C23H30O14 |
| Molecular Weight | 530.48 g/mol |
| Exact Mass | 530.16 |
| IUPAC Name | (1S,3R,4R,5R)-1,3,4-trihydroxy-5-[(E)-3-[3-methoxy-4-[(2R,3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyphenyl]prop-2-enoyl]oxycyclohexane-1-carboxylic acid |
| SMILES | COc1cc(/C=C/C(=O)O[C@@H]2C[C@](O)(C(=O)O)C[C@@H](O)[C@H]2O)ccc1O[C@H]1O[C@@H](CO)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C23H30O14/c1-34-13-6-10(2-4-12(13)36-21-20(30)19(29)18(28)15(9-24)37-21)3-5-16(26)35-14-8-23(33,22(31)32)7-11(25)17(14)27/h2-6,11,14-15,17-21,24-25,27-30,33H,7-9H2,1H3,(H,31,32)/b5-3+/t11-,14-,15+,17-,18+,19-,20+,21+,23+/m1/s1 |
| InChIKey | WGPJMKWCIFKCET-XRGTWEPOSA-N |
| XLogP | -2.87 |
| TPSA | 232.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.48 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|