C21H16FN5S — CID 11192854
(2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[2-(3-fluorophenyl)ethylamino]pyrimidin-4-yl]acetonitrile (PubChem CID 11192854) has the molecular formula C21H16FN5S and a molecular weight of 389.46 g/mol. Its IUPAC name is (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[2-(3-fluorophenyl)ethylamino]pyrimidin-4-yl]acetonitrile.
| Compound Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[2-(3-fluorophenyl)ethylamino]pyrimidin-4-yl]acetonitrile |
|---|---|
| PubChem CID | 11192854 |
| Molecular Formula | C21H16FN5S |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.11 |
| IUPAC Name | (2Z)-2-(3H-1,3-benzothiazol-2-ylidene)-2-[2-[2-(3-fluorophenyl)ethylamino]pyrimidin-4-yl]acetonitrile |
| SMILES | N#C/C(=C1/Nc2ccccc2S1)c1ccnc(NCCc2cccc(F)c2)n1 |
| InChI | InChI=1S/C21H16FN5S/c22-15-5-3-4-14(12-15)8-10-24-21-25-11-9-17(27-21)16(13-23)20-26-18-6-1-2-7-19(18)28-20/h1-7,9,11-12,26H,8,10H2,(H,24,25,27)/b20-16+ |
| InChIKey | VVGCDPREGFDTDN-CAPFRKAQSA-N |
| XLogP | 4.68 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|