C24H44IN5O3 — CID 111931827
1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-ethyl-2-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide (PubChem CID 111931827) has the molecular formula C24H44IN5O3 and a molecular weight of 577.55 g/mol. Its IUPAC name is 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-ethyl-2-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-ethyl-2-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111931827 |
| Molecular Formula | C24H44IN5O3 |
| Molecular Weight | 577.55 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 1-[2-(3,4-dimethoxyphenyl)-2-(dimethylamino)ethyl]-3-ethyl-2-(3-methyl-2-morpholin-4-ylbutyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C(C)C)N1CCOCC1)NCC(c1ccc(OC)c(OC)c1)N(C)C.I |
| InChI | InChI=1S/C24H43N5O3.HI/c1-8-25-24(26-16-20(18(2)3)29-11-13-32-14-12-29)27-17-21(28(4)5)19-9-10-22(30-6)23(15-19)31-7;/h9-10,15,18,20-21H,8,11-14,16-17H2,1-7H3,(H2,25,26,27);1H |
| InChIKey | ZGHRJMKVJJLAFG-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.55 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|