C24H44IN5O3 — CID 111312967
2-[2-(diethylamino)propyl]-1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-ethylguanidine;hydroiodide (PubChem CID 111312967) has the molecular formula C24H44IN5O3 and a molecular weight of 577.55 g/mol. Its IUPAC name is 2-[2-(diethylamino)propyl]-1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-ethylguanidine;hydroiodide.
| Compound Name | 2-[2-(diethylamino)propyl]-1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-ethylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111312967 |
| Molecular Formula | C24H44IN5O3 |
| Molecular Weight | 577.55 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 2-[2-(diethylamino)propyl]-1-[2-(3,4-dimethoxyphenyl)-2-morpholin-4-ylethyl]-3-ethylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(C)N(CC)CC)NCC(c1ccc(OC)c(OC)c1)N1CCOCC1.I |
| InChI | InChI=1S/C24H43N5O3.HI/c1-7-25-24(26-17-19(4)28(8-2)9-3)27-18-21(29-12-14-32-15-13-29)20-10-11-22(30-5)23(16-20)31-6;/h10-11,16,19,21H,7-9,12-15,17-18H2,1-6H3,(H2,25,26,27);1H |
| InChIKey | JBTVEFTXTOQXIE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.55 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|