C23H39N5O3 — CID 111935215
2-[[ethylamino-[(4-methyl-2-morpholin-4-ylpentyl)amino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 111935215) has the molecular formula C23H39N5O3 and a molecular weight of 433.60 g/mol. Its IUPAC name is 2-[[ethylamino-[(4-methyl-2-morpholin-4-ylpentyl)amino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-[[ethylamino-[(4-methyl-2-morpholin-4-ylpentyl)amino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 111935215 |
| Molecular Formula | C23H39N5O3 |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.31 |
| IUPAC Name | 2-[[ethylamino-[(4-methyl-2-morpholin-4-ylpentyl)amino]methylidene]amino]-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccc(OC)cc1)NCC(CC(C)C)N1CCOCC1 |
| InChI | InChI=1S/C23H39N5O3/c1-5-24-23(26-16-20(14-18(2)3)28-10-12-31-13-11-28)27-17-22(29)25-15-19-6-8-21(30-4)9-7-19/h6-9,18,20H,5,10-17H2,1-4H3,(H,25,29)(H2,24,26,27) |
| InChIKey | REGNANYVWRFQSI-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|