C19H29IN6S — CID 111939246
1-ethyl-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111939246) has the molecular formula C19H29IN6S and a molecular weight of 500.45 g/mol. Its IUPAC name is 1-ethyl-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111939246 |
| Molecular Formula | C19H29IN6S |
| Molecular Weight | 500.45 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 1-ethyl-3-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-2-(thiophen-3-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccsc1)NCc1ccc(N2CCN(C)CC2)nc1.I |
| InChI | InChI=1S/C19H28N6S.HI/c1-3-20-19(23-14-17-6-11-26-15-17)22-13-16-4-5-18(21-12-16)25-9-7-24(2)8-10-25;/h4-6,11-12,15H,3,7-10,13-14H2,1-2H3,(H2,20,22,23);1H |
| InChIKey | RMNYGIUKNYJUTN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|