C18H29N9 — CID 111707065
1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111707065) has the molecular formula C18H29N9 and a molecular weight of 371.49 g/mol. Its IUPAC name is 1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111707065 |
| Molecular Formula | C18H29N9 |
| Molecular Weight | 371.49 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 1-ethyl-2-[[6-(4-methylpiperazin-1-yl)-3-pyridinyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(N2CCN(C)CC2)nc1)NCc1ncnn1C |
| InChI | InChI=1S/C18H29N9/c1-4-19-18(22-13-17-23-14-24-26(17)3)21-12-15-5-6-16(20-11-15)27-9-7-25(2)8-10-27/h5-6,11,14H,4,7-10,12-13H2,1-3H3,(H2,19,21,22) |
| InChIKey | CBAPPNRUKAHRLL-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 86.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.49 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|