C15H28IN5OS — CID 111941834
N,N-diethyl-3-[[N-ethyl-N'-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide (PubChem CID 111941834) has the molecular formula C15H28IN5OS and a molecular weight of 453.39 g/mol. Its IUPAC name is N,N-diethyl-3-[[N-ethyl-N'-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide.
| Compound Name | N,N-diethyl-3-[[N-ethyl-N'-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
|---|---|
| PubChem CID | 111941834 |
| Molecular Formula | C15H28IN5OS |
| Molecular Weight | 453.39 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | N,N-diethyl-3-[[N-ethyl-N'-[(2-methyl-1,3-thiazol-5-yl)methyl]carbamimidoyl]amino]propanamide;hydroiodide |
| SMILES | CCN/C(=N\Cc1cnc(C)s1)NCCC(=O)N(CC)CC.I |
| InChI | InChI=1S/C15H27N5OS.HI/c1-5-16-15(19-11-13-10-18-12(4)22-13)17-9-8-14(21)20(6-2)7-3;/h10H,5-9,11H2,1-4H3,(H2,16,17,19);1H |
| InChIKey | UTGNYNCMOZIWLH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.39 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|