About 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine
1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine (PubChem CID 11194911) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine.
Molecular Properties
| Compound Name | 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine |
| PubChem CID | 11194911 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine |
| SMILES | C=C(/C=C(/C)N1CCCCC1)OCC |
| InChI | InChI=1S/C12H21NO/c1-4-14-12(3)10-11(2)13-8-6-5-7-9-13/h10H,3-9H2,1-2H3/b11-10- |
| InChIKey | QDCVWNAFSJLMNR-KHPPLWFESA-N |
| XLogP | 2.93 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine?
The IUPAC name of 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine (CID 11194911) is 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine.
What is the SMILES notation for 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine?
The canonical SMILES for 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine is C=C(/C=C(/C)N1CCCCC1)OCC.
What is the InChIKey of 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine?
The InChIKey is QDCVWNAFSJLMNR-KHPPLWFESA-N. The full InChI is InChI=1S/C12H21NO/c1-4-14-12(3)10-11(2)13-8-6-5-7-9-13/h10H,3-9H2,1-2H3/b11-10-.
What are the key properties of 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine?
1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine has a molecular weight of 195.31 g/mol, XLogP of 2.93, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2Z)-4-ethoxypenta-2,4-dien-2-yl]piperidine is sourced from PubChem (CID 11194911), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).